CAS 147644-07-3 is the registry number for (3,4-Dihydro-2H-benzo[b][1,4]dioxepin-7-yl)(phenyl)methanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dihydro-2H-1,5-benzodioxepin-7-yl(phenyl)methanone (CAS 147644-07-3) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: 3,4-dihydro-2H-1,5-benzodioxepin-7-yl(phenyl)methanone. InChIKey: ATBWIKKKUXNBHF-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,5-benzodioxepin-7-yl(phenyl)methanone |
| InChIKey | ATBWIKKKUXNBHF-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)C(=O)C3=CC=CC=C3)OC1 |
Computed by PubChem (NCBI)