Products 147676-99-1
CAS 147676-99-1 appears in our catalog under these names: 5-(2-Ethoxy-5-nitrophenyl)-1-methyl-3-propyl-1,4-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one, 98%, Nitrodenafil, Nitrodenafil, >95% (HPLC). Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer. Available pack sizes: on request, 500mg, 5g, 50mg.
5-(2-ethoxy-5-nitrophenyl)-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (CAS 147676-99-1) is a chemical compound with the molecular formula C17H19N5O4 and a molecular weight of 357.4 g/mol. IUPAC name: 5-(2-ethoxy-5-nitrophenyl)-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one. InChIKey: JMINGHHRIRWKPP-UHFFFAOYSA-N.
| Molecular formula | C17H19N5O4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 5-(2-ethoxy-5-nitrophenyl)-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| InChIKey | JMINGHHRIRWKPP-UHFFFAOYSA-N |
| SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)[N+](=O)[O-])OCC)C |
Computed by PubChem (NCBI)