CAS 1641544-09-3 is the registry number for TLR7 agonist 26. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]benzoic acid (CAS 1641544-09-3) is a chemical compound with the molecular formula C17H19N5O4 and a molecular weight of 357.4 g/mol. IUPAC name: 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]benzoic acid. InChIKey: JVVCWMDULJCEGQ-UHFFFAOYSA-N.
| Molecular formula | C17H19N5O4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]benzoic acid |
| InChIKey | JVVCWMDULJCEGQ-UHFFFAOYSA-N |
| SMILES | CCCCOC1=NC(=C2C(=N1)N(C(=O)N2)CC3=CC=C(C=C3)C(=O)O)N |
Computed by PubChem (NCBI)