Products 4294-16-0
CAS 4294-16-0 appears in our catalog under these names: N6-Benzyl Adenosine, >95% (HPLC), N6–Benzyladenosine, N6-Benzyladenosine, >95.0%(HPLC)(T), N6-Benzyladenosine, N6-Benzyladenosine 98%. Offered by: TRC, GLPBio, TCI, Biosynth, Thermo Scientific (Acros). Available pack sizes: 250mg, 500mg, 5g, 1g, 200mg, 2g, 10g, 1000g.
(2R,3R,4S,5R)-2-[6-(benzylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (CAS 4294-16-0) is a chemical compound with the molecular formula C17H19N5O4 and a molecular weight of 357.4 g/mol. IUPAC name: (2R,3R,4S,5R)-2-[6-(benzylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: MRPKNNSABYPGBF-LSCFUAHRSA-N.
| Molecular formula | C17H19N5O4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-[6-(benzylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | MRPKNNSABYPGBF-LSCFUAHRSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O |
Computed by PubChem (NCBI)