Products 147687-63-6

CAS 147687-63-6 is the registry number for Orotic Acid-15N2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,4-dioxo-(1,3-15N2)1H-pyrimidine-6-carboxylic acid (CAS 147687-63-6) is a chemical compound with the molecular formula C5H4N2O4 and a molecular weight of 158.08 g/mol. IUPAC name: 2,4-dioxo-(1,3-15N2)1H-pyrimidine-6-carboxylic acid. InChIKey: PXQPEWDEAKTCGB-AKZCFXPHSA-N.

Identity
Molecular formulaC5H4N2O4
Molecular weight158.08 g/mol
IUPAC name2,4-dioxo-(1,3-15N2)1H-pyrimidine-6-carboxylic acid
InChIKeyPXQPEWDEAKTCGB-AKZCFXPHSA-N
SMILESC1=C([15NH]C(=O)[15NH]C1=O)C(=O)O

Computed by PubChem (NCBI)