CAS 147687-63-6 is the registry number for Orotic Acid-15N2. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dioxo-(1,3-15N2)1H-pyrimidine-6-carboxylic acid (CAS 147687-63-6) is a chemical compound with the molecular formula C5H4N2O4 and a molecular weight of 158.08 g/mol. IUPAC name: 2,4-dioxo-(1,3-15N2)1H-pyrimidine-6-carboxylic acid. InChIKey: PXQPEWDEAKTCGB-AKZCFXPHSA-N.
| Molecular formula | C5H4N2O4 |
|---|---|
| Molecular weight | 158.08 g/mol |
| IUPAC name | 2,4-dioxo-(1,3-15N2)1H-pyrimidine-6-carboxylic acid |
| InChIKey | PXQPEWDEAKTCGB-AKZCFXPHSA-N |
| SMILES | C1=C([15NH]C(=O)[15NH]C1=O)C(=O)O |
Computed by PubChem (NCBI)