Products 147821-57-6
CAS 147821-57-6 appears in our catalog under these names: Niazinin, Niazinin, 99.94%, Niazinin, ≥98%, Niazinin, 98.0%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 5 mg, 10 mg, 20mg.
O-methyl N-[[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]methyl]carbamothioate (CAS 147821-57-6) is a chemical compound with the molecular formula C15H21NO6S and a molecular weight of 343.4 g/mol. IUPAC name: O-methyl N-[[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]methyl]carbamothioate. InChIKey: ZOIAMMQYAZSWRX-CNJBRALLSA-N.
| Molecular formula | C15H21NO6S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | O-methyl N-[[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]methyl]carbamothioate |
| InChIKey | ZOIAMMQYAZSWRX-CNJBRALLSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)CNC(=S)OC)O)O)O |
Computed by PubChem (NCBI)