CAS 2476729-51-6 appears in our catalog under these names: tert-Butyl (R)-4-((benzyloxy)methyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 95%, 95%, tert-Butyl (R)-4-((benzyloxy)methyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
Tert-butyl (4R)-2,2-dioxo-4-(phenylmethoxymethyl)oxathiazolidine-3-carboxylate (CAS 2476729-51-6) is a chemical compound with the molecular formula C15H21NO6S and a molecular weight of 343.4 g/mol. IUPAC name: tert-butyl (4R)-2,2-dioxo-4-(phenylmethoxymethyl)oxathiazolidine-3-carboxylate. InChIKey: SBDHXVMICOENAK-CYBMUJFWSA-N.
| Molecular formula | C15H21NO6S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | tert-butyl (4R)-2,2-dioxo-4-(phenylmethoxymethyl)oxathiazolidine-3-carboxylate |
| InChIKey | SBDHXVMICOENAK-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](COS1(=O)=O)COCC2=CC=CC=C2 |
Computed by PubChem (NCBI)