Products 2231667-19-7
CAS 2231667-19-7 is the registry number for 2–((tert–Butoxycarbonyl)amino)–2–(4–(ethylsulfonyl)phenyl)acetic acid. Offered by: GLPBio. Available pack sizes: 1g.
2-(4-ethylsulfonylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 2231667-19-7) is a chemical compound with the molecular formula C15H21NO6S and a molecular weight of 343.4 g/mol. IUPAC name: 2-(4-ethylsulfonylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZMBNOEBMTWWJEK-UHFFFAOYSA-N.
| Molecular formula | C15H21NO6S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 2-(4-ethylsulfonylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZMBNOEBMTWWJEK-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC=C(C=C1)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)