CAS 1478276-68-4 appears in our catalog under these names: 5-(5-Bromo-2-methylphenyl)-3-methyl-1H-1,2,4-triazole, 98%, 5-(5-Bromo-2-methylphenyl)-3-methyl-1H-1,2,4-triazole, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3-(5-bromo-2-methylphenyl)-5-methyl-1H-1,2,4-triazole (CAS 1478276-68-4) is a chemical compound with the molecular formula C10H10BrN3 and a molecular weight of 252.11 g/mol. IUPAC name: 3-(5-bromo-2-methylphenyl)-5-methyl-1H-1,2,4-triazole. InChIKey: MYKVYFFNOVPYDA-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3 |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 3-(5-bromo-2-methylphenyl)-5-methyl-1H-1,2,4-triazole |
| InChIKey | MYKVYFFNOVPYDA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)C2=NNC(=N2)C |
Computed by PubChem (NCBI)