Products 147977-05-7
CAS 147977-05-7 is the registry number for (S)-2-amino-2-(10,11-dihydro-5h-dibenzo(a,d)(7)annulen-5-yl)acetic acid hcl, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(2S)-2-amino-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)acetic acid;hydrochloride (CAS 147977-05-7) is a chemical compound with the molecular formula C17H18ClNO2 and a molecular weight of 303.8 g/mol. IUPAC name: (2S)-2-amino-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)acetic acid;hydrochloride. InChIKey: YVSJKKWERAGVDO-NTISSMGPSA-N.
| Molecular formula | C17H18ClNO2 |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)acetic acid;hydrochloride |
| InChIKey | YVSJKKWERAGVDO-NTISSMGPSA-N |
| SMILES | C1CC2=CC=CC=C2C(C3=CC=CC=C31)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)