CAS 147993-48-4 appears in our catalog under these names: Propan-2-yl 2,5-dihydroxybenzoate, 95%, Propan-2-yl 2,5-dihydroxybenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Propan-2-yl 2,5-dihydroxybenzoate (CAS 147993-48-4) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: propan-2-yl 2,5-dihydroxybenzoate. InChIKey: XYULNQQEVCBODY-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | propan-2-yl 2,5-dihydroxybenzoate |
| InChIKey | XYULNQQEVCBODY-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=C(C=CC(=C1)O)O |
Computed by PubChem (NCBI)