CAS 148000-30-0 appears in our catalog under these names: 2-Chloro-4-(trifluoromethyl)benzenethiol, 97%, 2-Chloro-4-trifluoromethylbenzenethiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-chloro-4-(trifluoromethyl)benzenethiol (CAS 148000-30-0) is a chemical compound with the molecular formula C7H4ClF3S and a molecular weight of 212.62 g/mol. IUPAC name: 2-chloro-4-(trifluoromethyl)benzenethiol. InChIKey: YSXXAMORSGVFKZ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3S |
|---|---|
| Molecular weight | 212.62 g/mol |
| IUPAC name | 2-chloro-4-(trifluoromethyl)benzenethiol |
| InChIKey | YSXXAMORSGVFKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)S |
Computed by PubChem (NCBI)