CAS 18800-22-1 is the registry number for 4-Chloro-3-trifluoromethyl-benzenethiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
4-chloro-3-(trifluoromethyl)benzenethiol (CAS 18800-22-1) is a chemical compound with the molecular formula C7H4ClF3S and a molecular weight of 212.62 g/mol. IUPAC name: 4-chloro-3-(trifluoromethyl)benzenethiol. InChIKey: VSZQSTUDNPQHCA-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3S |
|---|---|
| Molecular weight | 212.62 g/mol |
| IUPAC name | 4-chloro-3-(trifluoromethyl)benzenethiol |
| InChIKey | VSZQSTUDNPQHCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S)C(F)(F)F)Cl |
Computed by PubChem (NCBI)