CAS 398-74-3 is the registry number for 1-Chloro-2-((trifluoromethyl)sulfanyl)benzene, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-chloro-2-(trifluoromethylsulfanyl)benzene (CAS 398-74-3) is a chemical compound with the molecular formula C7H4ClF3S and a molecular weight of 212.62 g/mol. IUPAC name: 1-chloro-2-(trifluoromethylsulfanyl)benzene. InChIKey: XDQCDVMXZCAMJN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3S |
|---|---|
| Molecular weight | 212.62 g/mol |
| IUPAC name | 1-chloro-2-(trifluoromethylsulfanyl)benzene |
| InChIKey | XDQCDVMXZCAMJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)SC(F)(F)F)Cl |
Computed by PubChem (NCBI)