CAS 1480824-29-0 is the registry number for 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2,2,3-trimethylbutanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2,3-trimethylbutanoic acid (CAS 1480824-29-0) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2,3-trimethylbutanoic acid. InChIKey: KFMJYHYZOLYCNF-UHFFFAOYSA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2,3-trimethylbutanoic acid |
| InChIKey | KFMJYHYZOLYCNF-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)C(C)(C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)