CAS 1481121-41-8 is the registry number for 5-(3,4-Dichlorophenyl)-2-methylpiperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,4-dichlorophenyl)-2-methylpiperidine (CAS 1481121-41-8) is a chemical compound with the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-2-methylpiperidine. InChIKey: UJBJHQLAOQUDLX-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N |
|---|---|
| Molecular weight | 244.16 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-2-methylpiperidine |
| InChIKey | UJBJHQLAOQUDLX-UHFFFAOYSA-N |
| SMILES | CC1CCC(CN1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)