Products 148171-35-1
CAS 148171-35-1 is the registry number for 6-Amino-9-[2-deoxy-β-D-ribofuranosyl]-9H-purine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,5R)-5-(6-aminopurin-7-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 148171-35-1) is a chemical compound with the molecular formula C10H13N5O3 and a molecular weight of 251.24 g/mol. IUPAC name: (2R,3S,5R)-5-(6-aminopurin-7-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: VGSMHXAPKCTFOZ-RRKCRQDMSA-N.
| Molecular formula | C10H13N5O3 |
|---|---|
| Molecular weight | 251.24 g/mol |
| IUPAC name | (2R,3S,5R)-5-(6-aminopurin-7-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | VGSMHXAPKCTFOZ-RRKCRQDMSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=NC=NC(=C32)N)CO)O |
Computed by PubChem (NCBI)