CAS 148185-66-4 appears in our catalog under these names: 4,7–dibromo–1H–benzo(d)imidazole, 4,7-dibromo-1H-benzo(d)imidazole, 4,7-Dibromo-1H-benzo[d]imidazole 98%, 4,7-Dibromo-1H-1,3-benzodiazole, 95%, 95%, 4,7-Dibromo-1H-1,3-benzodiazole, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
4,7-dibromo-1H-benzimidazole (CAS 148185-66-4) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 4,7-dibromo-1H-benzimidazole. InChIKey: ZGLGYSCEKIFGMB-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 4,7-dibromo-1H-benzimidazole |
| InChIKey | ZGLGYSCEKIFGMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Br)NC=N2)Br |
Computed by PubChem (NCBI)