CAS 1482722-68-8 is the registry number for 4-((3-tert-Butyl-1,2,4-thiadiazol-5-yl)oxy)-3-chloroaniline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-3-chloroaniline (CAS 1482722-68-8) is a chemical compound with the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. IUPAC name: 4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-3-chloroaniline. InChIKey: WPUCWIJBRFURPY-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3OS |
|---|---|
| Molecular weight | 283.78 g/mol |
| IUPAC name | 4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-3-chloroaniline |
| InChIKey | WPUCWIJBRFURPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NSC(=N1)OC2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)