CAS 148305-62-8 is the registry number for AChE-IN-64. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-(4-bromophenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one (CAS 148305-62-8) is a chemical compound with the molecular formula C15H11BrO2 and a molecular weight of 303.15 g/mol. IUPAC name: (E)-1-(4-bromophenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: RJIFZRQOWIRRNC-XCVCLJGOSA-N.
| Molecular formula | C15H11BrO2 |
|---|---|
| Molecular weight | 303.15 g/mol |
| IUPAC name | (E)-1-(4-bromophenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | RJIFZRQOWIRRNC-XCVCLJGOSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)