CAS 18189-19-0 is the registry number for 4-Bromomethylbenzil. Offered by: TRC, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g.
1-[4-(bromomethyl)phenyl]-2-phenylethane-1,2-dione (CAS 18189-19-0) is a chemical compound with the molecular formula C15H11BrO2 and a molecular weight of 303.15 g/mol. IUPAC name: 1-[4-(bromomethyl)phenyl]-2-phenylethane-1,2-dione. InChIKey: QELAVTMDKHSMOP-UHFFFAOYSA-N.
| Molecular formula | C15H11BrO2 |
|---|---|
| Molecular weight | 303.15 g/mol |
| IUPAC name | 1-[4-(bromomethyl)phenyl]-2-phenylethane-1,2-dione |
| InChIKey | QELAVTMDKHSMOP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)