CAS 25856-02-4 is the registry number for 1-(3-Bromophenyl)-3-phenyl-1,3-propanedione, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
1-(3-bromophenyl)-3-phenylpropane-1,3-dione (CAS 25856-02-4) is a chemical compound with the molecular formula C15H11BrO2 and a molecular weight of 303.15 g/mol. IUPAC name: 1-(3-bromophenyl)-3-phenylpropane-1,3-dione. InChIKey: FCRMMLQWCOHDJC-UHFFFAOYSA-N.
| Molecular formula | C15H11BrO2 |
|---|---|
| Molecular weight | 303.15 g/mol |
| IUPAC name | 1-(3-bromophenyl)-3-phenylpropane-1,3-dione |
| InChIKey | FCRMMLQWCOHDJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)