Products 148383-11-3
CAS 148383-11-3 appears in our catalog under these names: Methyl (((9H–fluoren–9–yl)methoxy)carbonyl)–L–isoleucinate, Methyl (((9H-fluoren-9-yl)methoxy)carbonyl)-L-isoleucinate, 97%, 97%, Methyl Fmoc-L-isoleucinate, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg.
Methyl (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate (CAS 148383-11-3) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: methyl (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate. InChIKey: IIDWGJXDOVAEEJ-XOBRGWDASA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | methyl (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate |
| InChIKey | IIDWGJXDOVAEEJ-XOBRGWDASA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)