Products 1484164-20-6
CAS 1484164-20-6 is the registry number for 4-(1,3-Dimethyl-1H-pyrazole-5-carbonyl)piperazin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,5-dimethylpyrazole-3-carbonyl)piperazin-2-one (CAS 1484164-20-6) is a chemical compound with the molecular formula C10H14N4O2 and a molecular weight of 222.24 g/mol. IUPAC name: 4-(2,5-dimethylpyrazole-3-carbonyl)piperazin-2-one. InChIKey: LKFNINMTIYYYRO-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 4-(2,5-dimethylpyrazole-3-carbonyl)piperazin-2-one |
| InChIKey | LKFNINMTIYYYRO-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(=O)N2CCNC(=O)C2)C |
Computed by PubChem (NCBI)