Products 1484323-35-4

CAS 1484323-35-4 is the registry number for 3-(4-Ethyl-1,2,3-thiadiazole-5-carboxamido)-2-methylpropanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(4-ethylthiadiazole-5-carbonyl)amino]-2-methylpropanoic acid (CAS 1484323-35-4) is a chemical compound with the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. IUPAC name: 3-[(4-ethylthiadiazole-5-carbonyl)amino]-2-methylpropanoic acid. InChIKey: COGJSWDGCIRWNR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13N3O3S
Molecular weight243.29 g/mol
IUPAC name3-[(4-ethylthiadiazole-5-carbonyl)amino]-2-methylpropanoic acid
InChIKeyCOGJSWDGCIRWNR-UHFFFAOYSA-N
SMILESCCC1=C(SN=N1)C(=O)NCC(C)C(=O)O

Computed by PubChem (NCBI)