Products 1821068-16-9
CAS 1821068-16-9 is the registry number for Isopropyl (Z)-2-(2-aminothiazol-4-yl)-2-(methoxyimino)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate (CAS 1821068-16-9) is a chemical compound with the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. IUPAC name: propan-2-yl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate. InChIKey: DUXGPQWNZWSJHK-GHXNOFRVSA-N.
| Molecular formula | C9H13N3O3S |
|---|---|
| Molecular weight | 243.29 g/mol |
| IUPAC name | propan-2-yl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate |
| InChIKey | DUXGPQWNZWSJHK-GHXNOFRVSA-N |
| SMILES | CC(C)OC(=O)/C(=N\OC)/C1=CSC(=N1)N |
Computed by PubChem (NCBI)