CAS 1803591-27-6 is the registry number for 7-(Ethanesulfonyl)-3H,4H,5H,6H,7H,8H-pyrido(3,4-d)pyrimidin-4-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
7-ethylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (CAS 1803591-27-6) is a chemical compound with the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. IUPAC name: 7-ethylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one. InChIKey: VGSVOKKMUDRCLE-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O3S |
|---|---|
| Molecular weight | 243.29 g/mol |
| IUPAC name | 7-ethylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| InChIKey | VGSVOKKMUDRCLE-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N1CCC2=C(C1)N=CNC2=O |
Computed by PubChem (NCBI)