Products 1484536-54-0
CAS 1484536-54-0 appears in our catalog under these names: 1,1-Dimethyl 3-hydroxycyclobutane-1,1-dicarboxylate, 95%, Dimethyl 3-hydroxycyclobutane-1,1-dicarboxylate, 95%, 1,1-dimethyl 3-hydroxycyclobutane-1,1-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg.
Dimethyl 3-hydroxycyclobutane-1,1-dicarboxylate (CAS 1484536-54-0) is a chemical compound with the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. IUPAC name: dimethyl 3-hydroxycyclobutane-1,1-dicarboxylate. InChIKey: UBSZDSCVVVYFQX-UHFFFAOYSA-N.
| Molecular formula | C8H12O5 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | dimethyl 3-hydroxycyclobutane-1,1-dicarboxylate |
| InChIKey | UBSZDSCVVVYFQX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC(C1)O)C(=O)OC |
Computed by PubChem (NCBI)