Products 388578-39-0
CAS 388578-39-0 is the registry number for (2R,3S,4R,5S,6R)-2-ethynyl-6-(hydroxymethyl)oxane-3,4,5-triol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4R,5S,6R)-2-ethynyl-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 388578-39-0) is a chemical compound with the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. IUPAC name: (2R,3S,4R,5S,6R)-2-ethynyl-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: ZAEJKEDRBYAUHS-FMDGEEDCSA-N.
| Molecular formula | C8H12O5 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | (2R,3S,4R,5S,6R)-2-ethynyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | ZAEJKEDRBYAUHS-FMDGEEDCSA-N |
| SMILES | C#C[C@@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)