Products 65940-93-4
CAS 65940-93-4 appears in our catalog under these names: Isosorbide Impurity 11, Isosorbide Impurity 6, Isosorbide Impurity 16. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] acetate (CAS 65940-93-4) is a chemical compound with the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. IUPAC name: [(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] acetate. InChIKey: ASUQMWUAFHPXOG-LXGUWJNJSA-N.
| Molecular formula | C8H12O5 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | [(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] acetate |
| InChIKey | ASUQMWUAFHPXOG-LXGUWJNJSA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O |
Computed by PubChem (NCBI)