CAS 1484841-44-2 appears in our catalog under these names: (4-(Isoquinolin-4-yl)phenyl)methanamine, 98%, 4-Isoquinolin-4-yl-benzylamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(4-isoquinolin-4-ylphenyl)methanamine (CAS 1484841-44-2) is a chemical compound with the molecular formula C16H14N2 and a molecular weight of 234.29 g/mol. IUPAC name: (4-isoquinolin-4-ylphenyl)methanamine. InChIKey: NDGYZJONJUPVAC-UHFFFAOYSA-N.
| Molecular formula | C16H14N2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | (4-isoquinolin-4-ylphenyl)methanamine |
| InChIKey | NDGYZJONJUPVAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NC=C2C3=CC=C(C=C3)CN |
Computed by PubChem (NCBI)