CAS 3729-90-6 is the registry number for 1,5-Diphenyl-3-methylpyrazole, >95% (HPLC). Offered by: TRC. Available pack sizes: 200mg, 25mg, 50mg.
3-methyl-1,5-diphenylpyrazole (CAS 3729-90-6) is a chemical compound with the molecular formula C16H14N2 and a molecular weight of 234.29 g/mol. IUPAC name: 3-methyl-1,5-diphenylpyrazole. InChIKey: YHKSOEKUCNSKLN-UHFFFAOYSA-N.
| Molecular formula | C16H14N2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 3-methyl-1,5-diphenylpyrazole |
| InChIKey | YHKSOEKUCNSKLN-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)