CAS 6637-10-1 appears in our catalog under these names: 3-(Indolin-2-yl)-1H-indole, 95-<97%, VPC13163. Offered by: Hoffman Fine Chemicals, Chemat, MedChemExpress. Available pack sizes: 5g, 10g, 25g, 1mg, 2mg, 5mg, 10mg, 25mg.
3-(2,3-dihydro-1H-indol-2-yl)-1H-indole (CAS 6637-10-1) is a chemical compound with the molecular formula C16H14N2 and a molecular weight of 234.29 g/mol. IUPAC name: 3-(2,3-dihydro-1H-indol-2-yl)-1H-indole. InChIKey: OGXXVLOAJZDVFY-UHFFFAOYSA-N.
| Molecular formula | C16H14N2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 3-(2,3-dihydro-1H-indol-2-yl)-1H-indole |
| InChIKey | OGXXVLOAJZDVFY-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C21)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)