CAS 1485081-34-2 appears in our catalog under these names: Methyl Belinostat, Belinostat Impurity 7 (Methyl Belinostat). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(E)-N-methoxy-3-[3-(phenylsulfamoyl)phenyl]prop-2-enamide (CAS 1485081-34-2) is a chemical compound with the molecular formula C16H16N2O4S and a molecular weight of 332.4 g/mol. IUPAC name: (E)-N-methoxy-3-[3-(phenylsulfamoyl)phenyl]prop-2-enamide. InChIKey: STHZFQBKWSPNQA-ZHACJKMWSA-N.
| Molecular formula | C16H16N2O4S |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | (E)-N-methoxy-3-[3-(phenylsulfamoyl)phenyl]prop-2-enamide |
| InChIKey | STHZFQBKWSPNQA-ZHACJKMWSA-N |
| SMILES | CONC(=O)/C=C/C1=CC(=CC=C1)S(=O)(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)