Products 2418591-42-9

CAS 2418591-42-9 is the registry number for Febuxostat Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1-oxo-1,3-thiazole-5-carboxylic acid (CAS 2418591-42-9) is a chemical compound with the molecular formula C16H16N2O4S and a molecular weight of 332.4 g/mol. IUPAC name: 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1-oxo-1,3-thiazole-5-carboxylic acid. InChIKey: KEOXYHYYRVCCAU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16N2O4S
Molecular weight332.4 g/mol
IUPAC name2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1-oxo-1,3-thiazole-5-carboxylic acid
InChIKeyKEOXYHYYRVCCAU-UHFFFAOYSA-N
SMILESCC1=C(S(=O)C(=N1)C2=CC(=C(C=C2)OCC(C)C)C#N)C(=O)O

Computed by PubChem (NCBI)