Products 27255-72-7
CAS 27255-72-7 appears in our catalog under these names: Cefradine Impurity 19, Cefalexin Impurity 15. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(6R,7R)-3-methyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 27255-72-7) is a chemical compound with the molecular formula C16H16N2O4S and a molecular weight of 332.4 g/mol. IUPAC name: (6R,7R)-3-methyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: CIPQGGYPCPIDBB-IUODEOHRSA-N.
| Molecular formula | C16H16N2O4S |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | (6R,7R)-3-methyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | CIPQGGYPCPIDBB-IUODEOHRSA-N |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)CC3=CC=CC=C3)SC1)C(=O)O |
Computed by PubChem (NCBI)