CAS 148516-65-8 appears in our catalog under these names: Amisulpride Impurity 46, Amisulpride Impurity 12. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-amino-5-ethylsulfonyl-2-hydroxybenzoic acid (CAS 148516-65-8) is a chemical compound with the molecular formula C9H11NO5S and a molecular weight of 245.25 g/mol. IUPAC name: 4-amino-5-ethylsulfonyl-2-hydroxybenzoic acid. InChIKey: TYRZIEQZUYXTJY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5S |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | 4-amino-5-ethylsulfonyl-2-hydroxybenzoic acid |
| InChIKey | TYRZIEQZUYXTJY-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(C=C(C(=C1)C(=O)O)O)N |
Computed by PubChem (NCBI)