Products 71675-99-5
CAS 71675-99-5 appears in our catalog under these names: 4-Amino-2-methoxy-5-(methylsulfonyl)benzoic Acid, Amisulpride Impurity 45, Amisulpride Impurity 13. Offered by: TRC, Chemat Brand, Hubei YoungXin. Available pack sizes: 5mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-amino-2-methoxy-5-methylsulfonylbenzoic acid (CAS 71675-99-5) is a chemical compound with the molecular formula C9H11NO5S and a molecular weight of 245.25 g/mol. IUPAC name: 4-amino-2-methoxy-5-methylsulfonylbenzoic acid. InChIKey: PGTLUUCBHDLKKY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5S |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | 4-amino-2-methoxy-5-methylsulfonylbenzoic acid |
| InChIKey | PGTLUUCBHDLKKY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)S(=O)(=O)C)N |
Computed by PubChem (NCBI)