CAS 84271-78-3 appears in our catalog under these names: 2,5–Dioxopyrrolidin–1–yl 3–(acetylthio)propanoate, N-Succinimidyl 3-(Acetylthio)propionate, >95.0%(GC), 3-(Acetylthio)propionic acid N-succinimidyl ester, 99.68%, 2,5-DIOXOPYRROLIDIN-1-YL 3-(ACETYLTHIO)PROPANOATE, 95%, 3-(Acetylthio)propionic acid N-succinimidyl ester, 98%. Offered by: GLPBio, TCI, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 100 mg, 10 g, 500 mg, 1 g, 5 g.
(2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate (CAS 84271-78-3) is a chemical compound with the molecular formula C9H11NO5S and a molecular weight of 245.25 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate. InChIKey: ZRTJVRDXVSDKPX-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5S |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate |
| InChIKey | ZRTJVRDXVSDKPX-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)