CAS 1485353-05-6 is the registry number for 2-Amino-1-(2,4-difluorophenyl)-2-methylpropan-1-ol, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
2-amino-1-(2,4-difluorophenyl)-2-methylpropan-1-ol (CAS 1485353-05-6) is a chemical compound with the molecular formula C10H13F2NO and a molecular weight of 201.21 g/mol. IUPAC name: 2-amino-1-(2,4-difluorophenyl)-2-methylpropan-1-ol. InChIKey: VKMQASQSRACRFG-UHFFFAOYSA-N.
| Molecular formula | C10H13F2NO |
|---|---|
| Molecular weight | 201.21 g/mol |
| IUPAC name | 2-amino-1-(2,4-difluorophenyl)-2-methylpropan-1-ol |
| InChIKey | VKMQASQSRACRFG-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C1=C(C=C(C=C1)F)F)O)N |
Computed by PubChem (NCBI)