Products 1485415-16-4

CAS 1485415-16-4 appears in our catalog under these names: [(2,5-Dichlorophenyl)methyl]triphenylphosphanium chloride, 95%, ((2,5-Dichlorophenyl)methyl)triphenylphosphanium chloride, 95%, ((2,5-Dichlorophenyl)methyl)triphenylphosphanium chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.

Structural formula: {0} (CAS {1})

(2,5-dichlorophenyl)methyl-triphenylphosphanium chloride (CAS 1485415-16-4) is a chemical compound with the molecular formula C25H20Cl3P and a molecular weight of 457.8 g/mol. IUPAC name: (2,5-dichlorophenyl)methyl-triphenylphosphanium chloride. InChIKey: MNFYLXDEDZLQBR-UHFFFAOYSA-M.

Identity
Molecular formulaC25H20Cl3P
Molecular weight457.8 g/mol
IUPAC name(2,5-dichlorophenyl)methyl-triphenylphosphanium chloride
InChIKeyMNFYLXDEDZLQBR-UHFFFAOYSA-M
SMILESC1=CC=C(C=C1)[P+](CC2=C(C=CC(=C2)Cl)Cl)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]

Computed by PubChem (NCBI)