Products 2492-23-1

CAS 2492-23-1 appears in our catalog under these names: 2,4–Dichlorobenzyl)triphenylphosphonium Chloride, (2,4-Dichlorobenzyl)triphenylphosphonium Chloride, >98.0%(HPLC)(T), (2,4-DICHLOROBENZYL)TRIPHENYLPHOSPHONIUM CHLORIDE, 98%, 98%, (2,4-Dichlorobenzyl)triphenylphosphonium chloride, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g.

Structural formula: {0} (CAS {1})

(2,4-dichlorophenyl)methyl-triphenylphosphanium chloride (CAS 2492-23-1) is a chemical compound with the molecular formula C25H20Cl3P and a molecular weight of 457.8 g/mol. IUPAC name: (2,4-dichlorophenyl)methyl-triphenylphosphanium chloride. InChIKey: FWBSWSPGFNAXPP-UHFFFAOYSA-M.

Identity
Molecular formulaC25H20Cl3P
Molecular weight457.8 g/mol
IUPAC name(2,4-dichlorophenyl)methyl-triphenylphosphanium chloride
InChIKeyFWBSWSPGFNAXPP-UHFFFAOYSA-M
SMILESC1=CC=C(C=C1)[P+](CC2=C(C=C(C=C2)Cl)Cl)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]

Computed by PubChem (NCBI)