CAS 18583-54-5 appears in our catalog under these names: 2,6-Dichlorobenzyl triphenylphosphonium chloride, 95%, (2,6-Dichlorobenzyl)triphenylphosphonium chloride, 95+%, 95+%, (2,6-Dichlorobenzyl)triphenylphosphonium chloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 10g.
(2,6-dichlorophenyl)methyl-triphenylphosphanium chloride (CAS 18583-54-5) is a chemical compound with the molecular formula C25H20Cl3P and a molecular weight of 457.8 g/mol. IUPAC name: (2,6-dichlorophenyl)methyl-triphenylphosphanium chloride. InChIKey: NBWPWZJEEQWREI-UHFFFAOYSA-M.
| Molecular formula | C25H20Cl3P |
|---|---|
| Molecular weight | 457.8 g/mol |
| IUPAC name | (2,6-dichlorophenyl)methyl-triphenylphosphanium chloride |
| InChIKey | NBWPWZJEEQWREI-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CC2=C(C=CC=C2Cl)Cl)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)