Products 1485521-76-3
CAS 1485521-76-3 is the registry number for MOPIPP, 98.54%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.
(E)-3-(5-methoxy-2-propyl-1H-indol-3-yl)-1-pyridin-4-ylprop-2-en-1-one (CAS 1485521-76-3) is a chemical compound with the molecular formula C20H20N2O2 and a molecular weight of 320.4 g/mol. IUPAC name: (E)-3-(5-methoxy-2-propyl-1H-indol-3-yl)-1-pyridin-4-ylprop-2-en-1-one. InChIKey: AKHPVAVYPREXID-SOFGYWHQSA-N.
| Molecular formula | C20H20N2O2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | (E)-3-(5-methoxy-2-propyl-1H-indol-3-yl)-1-pyridin-4-ylprop-2-en-1-one |
| InChIKey | AKHPVAVYPREXID-SOFGYWHQSA-N |
| SMILES | CCCC1=C(C2=C(N1)C=CC(=C2)OC)/C=C/C(=O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)