Products 148613-12-1

CAS 148613-12-1 is the registry number for (S)-2-amino-3-(2-fluoro-5-hydroxyphenyl)propanoic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-amino-3-(2-fluoro-5-hydroxyphenyl)propanoic acid (CAS 148613-12-1) is a chemical compound with the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. IUPAC name: (2S)-2-amino-3-(2-fluoro-5-hydroxyphenyl)propanoic acid. InChIKey: YTYMWTLCTJSNDC-QMMMGPOBSA-N.

Identity
Molecular formulaC9H10FNO3
Molecular weight199.18 g/mol
IUPAC name(2S)-2-amino-3-(2-fluoro-5-hydroxyphenyl)propanoic acid
InChIKeyYTYMWTLCTJSNDC-QMMMGPOBSA-N
SMILESC1=CC(=C(C=C1O)C[C@@H](C(=O)O)N)F

Computed by PubChem (NCBI)