Products 1486368-72-2
CAS 1486368-72-2 is the registry number for 1-(2-Amino-5-phenylthiophen-3-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-amino-5-phenylthiophen-3-yl)ethanone (CAS 1486368-72-2) is a chemical compound with the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. IUPAC name: 1-(2-amino-5-phenylthiophen-3-yl)ethanone. InChIKey: OLDJOSRXCZELIA-UHFFFAOYSA-N.
| Molecular formula | C12H11NOS |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 1-(2-amino-5-phenylthiophen-3-yl)ethanone |
| InChIKey | OLDJOSRXCZELIA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(SC(=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)