Products 1486484-83-6
CAS 1486484-83-6 is the registry number for (1S,2R,8R)-14-Oxa-7-azatetracyclo(6.6.1.0{1,11}.0{2,7})pentadeca-9,11-dien-13-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S,2R,8R)-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one (CAS 1486484-83-6) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: (1S,2R,8R)-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one. InChIKey: SWZMSZQQJRKFBP-LOWVWBTDSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (1S,2R,8R)-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one |
| InChIKey | SWZMSZQQJRKFBP-LOWVWBTDSA-N |
| SMILES | C1CCN2[C@H](C1)[C@]34C[C@@H]2C=CC3=CC(=O)O4 |
Computed by PubChem (NCBI)