Products 1857-30-3
CAS 1857-30-3 appears in our catalog under these names: Securinine, 95%, (+)-Viroallosecurinine/ 100%, Viroallosecurinine, (+)-Viroallosecurinine, 99.0%. Offered by: Combi-blocks, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg.
(1R,2R,8R)-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one (CAS 1857-30-3) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: (1R,2R,8R)-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one. InChIKey: SWZMSZQQJRKFBP-DMDPSCGWSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (1R,2R,8R)-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadeca-9,11-dien-13-one |
| InChIKey | SWZMSZQQJRKFBP-DMDPSCGWSA-N |
| SMILES | C1CCN2[C@H](C1)[C@@]34C[C@@H]2C=CC3=CC(=O)O4 |
Computed by PubChem (NCBI)