CAS 1486804-63-0 appears in our catalog under these names: Propan-2-yl 5-(chlorosulfonyl)-2-methylbenzoate, 95%, Propan-2-yl 5-(chlorosulfonyl)-2-methylbenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Propan-2-yl 5-chlorosulfonyl-2-methylbenzoate (CAS 1486804-63-0) is a chemical compound with the molecular formula C11H13ClO4S and a molecular weight of 276.74 g/mol. IUPAC name: propan-2-yl 5-chlorosulfonyl-2-methylbenzoate. InChIKey: VVNXCCKCBNTZEG-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO4S |
|---|---|
| Molecular weight | 276.74 g/mol |
| IUPAC name | propan-2-yl 5-chlorosulfonyl-2-methylbenzoate |
| InChIKey | VVNXCCKCBNTZEG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)C(=O)OC(C)C |
Computed by PubChem (NCBI)