Products 2569010-08-6

CAS 2569010-08-6 is the registry number for 4-Cyclopropyl-2,6-dimethoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-cyclopropyl-2,6-dimethoxybenzenesulfonyl chloride (CAS 2569010-08-6) is a chemical compound with the molecular formula C11H13ClO4S and a molecular weight of 276.74 g/mol. IUPAC name: 4-cyclopropyl-2,6-dimethoxybenzenesulfonyl chloride. InChIKey: IEMDIHPJKKZEOV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClO4S
Molecular weight276.74 g/mol
IUPAC name4-cyclopropyl-2,6-dimethoxybenzenesulfonyl chloride
InChIKeyIEMDIHPJKKZEOV-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1S(=O)(=O)Cl)OC)C2CC2

Computed by PubChem (NCBI)