CAS 2569010-08-6 is the registry number for 4-Cyclopropyl-2,6-dimethoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-cyclopropyl-2,6-dimethoxybenzenesulfonyl chloride (CAS 2569010-08-6) is a chemical compound with the molecular formula C11H13ClO4S and a molecular weight of 276.74 g/mol. IUPAC name: 4-cyclopropyl-2,6-dimethoxybenzenesulfonyl chloride. InChIKey: IEMDIHPJKKZEOV-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO4S |
|---|---|
| Molecular weight | 276.74 g/mol |
| IUPAC name | 4-cyclopropyl-2,6-dimethoxybenzenesulfonyl chloride |
| InChIKey | IEMDIHPJKKZEOV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1S(=O)(=O)Cl)OC)C2CC2 |
Computed by PubChem (NCBI)